C22H22ClN3O4 — CID 126030921
N-[(E)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]-2-quinolin-8-yloxyacetamide (PubChem CID 126030921) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]-2-quinolin-8-yloxyacetamide.
| Compound Name | N-[(E)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]-2-quinolin-8-yloxyacetamide |
|---|---|
| PubChem CID | 126030921 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[(E)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]-2-quinolin-8-yloxyacetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)COc2cccc3cccnc23)cc(Cl)c1OCC |
| InChI | InChI=1S/C22H22ClN3O4/c1-3-28-19-12-15(11-17(23)22(19)29-4-2)13-25-26-20(27)14-30-18-9-5-7-16-8-6-10-24-21(16)18/h5-13H,3-4,14H2,1-2H3,(H,26,27)/b25-13+ |
| InChIKey | QTUUENJNMDFTLP-DHRITJCHSA-N |
| XLogP | 4.21 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|