C22H19FN4O3 — CID 6091071
N-(4-fluorophenyl)-2-[4-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]phenoxy]acetamide (PubChem CID 6091071) has the molecular formula C22H19FN4O3 and a molecular weight of 406.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 6091071 |
| Molecular Formula | C22H19FN4O3 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(/C=N\NC(=O)Nc2ccccc2)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H19FN4O3/c23-17-8-10-19(11-9-17)25-21(28)15-30-20-12-6-16(7-13-20)14-24-27-22(29)26-18-4-2-1-3-5-18/h1-14H,15H2,(H,25,28)(H2,26,27,29)/b24-14- |
| InChIKey | ATLBXVXTFJTBPU-OYKKKHCWSA-N |
| XLogP | 4.00 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|