C22H19N3O4 — CID 1105534
N-[[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2-hydroxybenzamide (PubChem CID 1105534) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is N-[[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 1105534 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2-hydroxybenzamide |
| SMILES | O=C(COc1ccc(C=NNC(=O)c2ccccc2O)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C22H19N3O4/c26-20-9-5-4-8-19(20)22(28)25-23-14-16-10-12-18(13-11-16)29-15-21(27)24-17-6-2-1-3-7-17/h1-14,26H,15H2,(H,24,27)(H,25,28) |
| InChIKey | CCINUCVYCWIIPV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|