C29H24ClN3O4 — CID 19657451
N-[(E)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2-[(2-chlorophenyl)methoxy]benzamide (PubChem CID 19657451) has the molecular formula C29H24ClN3O4 and a molecular weight of 513.98 g/mol. Its IUPAC name is N-[(E)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2-[(2-chlorophenyl)methoxy]benzamide.
| Compound Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2-[(2-chlorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 19657451 |
| Molecular Formula | C29H24ClN3O4 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2-[(2-chlorophenyl)methoxy]benzamide |
| SMILES | O=C(COc1ccc(/C=N/NC(=O)c2ccccc2OCc2ccccc2Cl)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C29H24ClN3O4/c30-26-12-6-4-8-22(26)19-37-27-13-7-5-11-25(27)29(35)33-31-18-21-14-16-24(17-15-21)36-20-28(34)32-23-9-2-1-3-10-23/h1-18H,19-20H2,(H,32,34)(H,33,35)/b31-18+ |
| InChIKey | MYYSRWQOLHNFOU-FDAWAROLSA-N |
| XLogP | 5.70 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|