C29H25N3O3 — CID 94833111
N-[(E)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2,2-diphenylacetamide (PubChem CID 94833111) has the molecular formula C29H25N3O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[(E)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 94833111 |
| Molecular Formula | C29H25N3O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)phenyl]methylideneamino]-2,2-diphenylacetamide |
| SMILES | O=C(COc1ccc(/C=N/NC(=O)C(c2ccccc2)c2ccccc2)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C29H25N3O3/c33-27(31-25-14-8-3-9-15-25)21-35-26-18-16-22(17-19-26)20-30-32-29(34)28(23-10-4-1-5-11-23)24-12-6-2-7-13-24/h1-20,28H,21H2,(H,31,33)(H,32,34)/b30-20+ |
| InChIKey | AHWBJYAYYZWOSS-TWKHWXDSSA-N |
| XLogP | 4.99 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|