C27H28N4O5 — CID 126011213
ethyl N-[(1R)-3-[(2Z)-2-[[4-(2-anilino-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate (PubChem CID 126011213) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is ethyl N-[(1R)-3-[(2Z)-2-[[4-(2-anilino-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate.
| Compound Name | ethyl N-[(1R)-3-[(2Z)-2-[[4-(2-anilino-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 126011213 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | ethyl N-[(1R)-3-[(2Z)-2-[[4-(2-anilino-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate |
| SMILES | CCOC(=O)N[C@H](CC(=O)N/N=C\c1ccc(OCC(=O)Nc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H28N4O5/c1-2-35-27(34)30-24(21-9-5-3-6-10-21)17-25(32)31-28-18-20-13-15-23(16-14-20)36-19-26(33)29-22-11-7-4-8-12-22/h3-16,18,24H,2,17,19H2,1H3,(H,29,33)(H,30,34)(H,31,32)/b28-18-/t24-/m1/s1 |
| InChIKey | XSLGBMNLHOXECV-IVRBHCBNSA-N |
| XLogP | 4.03 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|