C21H23N3O6 — CID 126008937
2-[3-[(Z)-[[(3R)-3-(ethoxycarbonylamino)-3-phenylpropanoyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 126008937) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-[3-[(Z)-[[(3R)-3-(ethoxycarbonylamino)-3-phenylpropanoyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(Z)-[[(3R)-3-(ethoxycarbonylamino)-3-phenylpropanoyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126008937 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-[3-[(Z)-[[(3R)-3-(ethoxycarbonylamino)-3-phenylpropanoyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOC(=O)N[C@H](CC(=O)N/N=C\c1cccc(OCC(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O6/c1-2-29-21(28)23-18(16-8-4-3-5-9-16)12-19(25)24-22-13-15-7-6-10-17(11-15)30-14-20(26)27/h3-11,13,18H,2,12,14H2,1H3,(H,23,28)(H,24,25)(H,26,27)/b22-13-/t18-/m1/s1 |
| InChIKey | NFJPFFPOOCACMW-QLTNSANVSA-N |
| XLogP | 2.48 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|