C19H19BrIN3O4 — CID 137127338
ethyl N-[(1S)-3-[(2Z)-2-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate (PubChem CID 137127338) has the molecular formula C19H19BrIN3O4 and a molecular weight of 560.19 g/mol. Its IUPAC name is ethyl N-[(1S)-3-[(2Z)-2-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate.
| Compound Name | ethyl N-[(1S)-3-[(2Z)-2-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 137127338 |
| Molecular Formula | C19H19BrIN3O4 |
| Molecular Weight | 560.19 g/mol |
| Exact Mass | 558.96 |
| IUPAC Name | ethyl N-[(1S)-3-[(2Z)-2-[(5-bromo-2-hydroxy-3-iodophenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate |
| SMILES | CCOC(=O)N[C@@H](CC(=O)N/N=C\c1cc(Br)cc(I)c1O)c1ccccc1 |
| InChI | InChI=1S/C19H19BrIN3O4/c1-2-28-19(27)23-16(12-6-4-3-5-7-12)10-17(25)24-22-11-13-8-14(20)9-15(21)18(13)26/h3-9,11,16,26H,2,10H2,1H3,(H,23,27)(H,24,25)/b22-11-/t16-/m0/s1 |
| InChIKey | BCXRZZGKZRXKEI-VBHHZLGVSA-N |
| XLogP | 4.09 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.19 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|