C29H36N4O3 — CID 126003842
ethyl N-[(1R)-3-[(2Z)-2-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate (PubChem CID 126003842) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is ethyl N-[(1R)-3-[(2Z)-2-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate.
| Compound Name | ethyl N-[(1R)-3-[(2Z)-2-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 126003842 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | ethyl N-[(1R)-3-[(2Z)-2-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate |
| SMILES | CCOC(=O)N[C@H](CC(=O)N/N=C\c1cc(C)n(-c2ccc(C(C)(C)C)cc2)c1C)c1ccccc1 |
| InChI | InChI=1S/C29H36N4O3/c1-7-36-28(35)31-26(22-11-9-8-10-12-22)18-27(34)32-30-19-23-17-20(2)33(21(23)3)25-15-13-24(14-16-25)29(4,5)6/h8-17,19,26H,7,18H2,1-6H3,(H,31,35)(H,32,34)/b30-19-/t26-/m1/s1 |
| InChIKey | CZHUSIMJACYASQ-KAECXJSPSA-N |
| XLogP | 5.72 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|