C33H32N4O5 — CID 126010436
N-[(1S)-3-[(2Z)-2-[[4-(2-anilino-2-oxoethoxy)-3-ethoxyphenyl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 126010436) has the molecular formula C33H32N4O5 and a molecular weight of 564.64 g/mol. Its IUPAC name is N-[(1S)-3-[(2Z)-2-[[4-(2-anilino-2-oxoethoxy)-3-ethoxyphenyl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | N-[(1S)-3-[(2Z)-2-[[4-(2-anilino-2-oxoethoxy)-3-ethoxyphenyl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 126010436 |
| Molecular Formula | C33H32N4O5 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | N-[(1S)-3-[(2Z)-2-[[4-(2-anilino-2-oxoethoxy)-3-ethoxyphenyl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C[C@H](NC(=O)c2ccccc2)c2ccccc2)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C33H32N4O5/c1-2-41-30-20-24(18-19-29(30)42-23-32(39)35-27-16-10-5-11-17-27)22-34-37-31(38)21-28(25-12-6-3-7-13-25)36-33(40)26-14-8-4-9-15-26/h3-20,22,28H,2,21,23H2,1H3,(H,35,39)(H,36,40)(H,37,38)/b34-22-/t28-/m0/s1 |
| InChIKey | VGTDWGHFIKQBAT-REHUEKKTSA-N |
| XLogP | 5.11 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|