C28H25N3O4 — CID 94833119
N-[(E)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]-2,2-diphenylacetamide (PubChem CID 94833119) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[(E)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(E)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 94833119 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-[(E)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]-2,2-diphenylacetamide |
| SMILES | O=C(COc1ccc(/C=N/NC(=O)C(c2ccccc2)c2ccccc2)cc1)NCc1ccco1 |
| InChI | InChI=1S/C28H25N3O4/c32-26(29-19-25-12-7-17-34-25)20-35-24-15-13-21(14-16-24)18-30-31-28(33)27(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-18,27H,19-20H2,(H,29,32)(H,31,33)/b30-18+ |
| InChIKey | RNSNEZFWWIIGGL-UXHLAJHPSA-N |
| XLogP | 4.26 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|