C28H25ClN4O6S — CID 126033900
2-(N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]acetamide (PubChem CID 126033900) has the molecular formula C28H25ClN4O6S and a molecular weight of 581.05 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126033900 |
| Molecular Formula | C28H25ClN4O6S |
| Molecular Weight | 581.05 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(/C=N\NC(=O)CN(c2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)cc1)NCc1ccco1 |
| InChI | InChI=1S/C28H25ClN4O6S/c29-22-10-14-26(15-11-22)40(36,37)33(23-5-2-1-3-6-23)19-27(34)32-31-17-21-8-12-24(13-9-21)39-20-28(35)30-18-25-7-4-16-38-25/h1-17H,18-20H2,(H,30,35)(H,32,34)/b31-17- |
| InChIKey | DFTMKYHMBFYRNG-LJUMEUDFSA-N |
| XLogP | 3.97 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.05 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|