C22H21N5O5 — CID 94832505
N'-[(Z)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]-N-(pyridin-4-ylmethyl)oxamide (PubChem CID 94832505) has the molecular formula C22H21N5O5 and a molecular weight of 435.44 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]-N-(pyridin-4-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]-N-(pyridin-4-ylmethyl)oxamide |
|---|---|
| PubChem CID | 94832505 |
| Molecular Formula | C22H21N5O5 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N'-[(Z)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]-N-(pyridin-4-ylmethyl)oxamide |
| SMILES | O=C(COc1ccc(/C=N\NC(=O)C(=O)NCc2ccncc2)cc1)NCc1ccco1 |
| InChI | InChI=1S/C22H21N5O5/c28-20(24-14-19-2-1-11-31-19)15-32-18-5-3-16(4-6-18)13-26-27-22(30)21(29)25-12-17-7-9-23-10-8-17/h1-11,13H,12,14-15H2,(H,24,28)(H,25,29)(H,27,30)/b26-13- |
| InChIKey | YYEPKFOAUVNABL-ZMFRSBBQSA-N |
| XLogP | 1.14 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|