C18H19N3O2 — CID 3102448
N'-(benzylideneamino)-N-(2-phenylethyl)propanediamide (PubChem CID 3102448) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is N'-(benzylideneamino)-N-(2-phenylethyl)propanediamide.
| Compound Name | N'-(benzylideneamino)-N-(2-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 3102448 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N'-(benzylideneamino)-N-(2-phenylethyl)propanediamide |
| SMILES | O=C(CC(=O)NN=Cc1ccccc1)NCCc1ccccc1 |
| InChI | InChI=1S/C18H19N3O2/c22-17(19-12-11-15-7-3-1-4-8-15)13-18(23)21-20-14-16-9-5-2-6-10-16/h1-10,14H,11-13H2,(H,19,22)(H,21,23) |
| InChIKey | IMCAXEGJXHLBDR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|