C20H23N3O4 — CID 6018671
N'-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-N-(2-phenylethyl)propanediamide (PubChem CID 6018671) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N'-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-N-(2-phenylethyl)propanediamide.
| Compound Name | N'-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-N-(2-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 6018671 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N'-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-N-(2-phenylethyl)propanediamide |
| SMILES | COc1cccc(/C=N\NC(=O)CC(=O)NCCc2ccccc2)c1OC |
| InChI | InChI=1S/C20H23N3O4/c1-26-17-10-6-9-16(20(17)27-2)14-22-23-19(25)13-18(24)21-12-11-15-7-4-3-5-8-15/h3-10,14H,11-13H2,1-2H3,(H,21,24)(H,23,25)/b22-14- |
| InChIKey | KRWGZTHNBXDWEJ-HMAPJEAMSA-N |
| XLogP | 1.90 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|