C19H22N4O2 — CID 94847602
N-benzyl-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]propanediamide (PubChem CID 94847602) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-benzyl-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]propanediamide.
| Compound Name | N-benzyl-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 94847602 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-benzyl-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]propanediamide |
| SMILES | CN(C)c1ccc(/C=N/NC(=O)CC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-23(2)17-10-8-16(9-11-17)14-21-22-19(25)12-18(24)20-13-15-6-4-3-5-7-15/h3-11,14H,12-13H2,1-2H3,(H,20,24)(H,22,25)/b21-14+ |
| InChIKey | KNAQNGPRKQZGOG-KGENOOAVSA-N |
| XLogP | 1.91 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|