C23H22N4O2 — CID 58350172
N-methyl-N'-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]propanediamide (PubChem CID 58350172) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-methyl-N'-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]propanediamide.
| Compound Name | N-methyl-N'-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 58350172 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-methyl-N'-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]propanediamide |
| SMILES | CNC(=O)CC(=O)N/N=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N4O2/c1-24-22(28)16-23(29)26-25-17-18-12-14-21(15-13-18)27(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,17H,16H2,1H3,(H,24,28)(H,26,29)/b25-17+ |
| InChIKey | FMZLZUMUWASSQW-KOEQRZSOSA-N |
| XLogP | 3.74 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|