C28H25N3O — CID 6901568
2,4-dimethyl-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]benzamide (PubChem CID 6901568) has the molecular formula C28H25N3O and a molecular weight of 419.53 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]benzamide.
| Compound Name | 2,4-dimethyl-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6901568 |
| Molecular Formula | C28H25N3O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2,4-dimethyl-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(C(=O)N/N=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C28H25N3O/c1-21-13-18-27(22(2)19-21)28(32)30-29-20-23-14-16-26(17-15-23)31(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-20H,1-2H3,(H,30,32)/b29-20+ |
| InChIKey | BGEPOUPMKXUGSV-ZTKZIYFRSA-N |
| XLogP | 6.54 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|