C18H20N2O — CID 7392408
2,4-dimethyl-N-[(Z)-[(2R)-2-phenylpropylidene]amino]benzamide (PubChem CID 7392408) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(Z)-[(2R)-2-phenylpropylidene]amino]benzamide.
| Compound Name | 2,4-dimethyl-N-[(Z)-[(2R)-2-phenylpropylidene]amino]benzamide |
|---|---|
| PubChem CID | 7392408 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2,4-dimethyl-N-[(Z)-[(2R)-2-phenylpropylidene]amino]benzamide |
| SMILES | Cc1ccc(C(=O)N/N=C\[C@H](C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C18H20N2O/c1-13-9-10-17(14(2)11-13)18(21)20-19-12-15(3)16-7-5-4-6-8-16/h4-12,15H,1-3H3,(H,20,21)/b19-12-/t15-/m0/s1 |
| InChIKey | LVBFNKTWFUMMQR-CCRNYGKSSA-N |
| XLogP | 3.82 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|