C26H23N3O2 — CID 5223464
2,5-dimethyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]furan-3-carboxamide (PubChem CID 5223464) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2,5-dimethyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]furan-3-carboxamide |
|---|---|
| PubChem CID | 5223464 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2,5-dimethyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]furan-3-carboxamide |
| SMILES | Cc1cc(C(=O)NN=Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)c(C)o1 |
| InChI | InChI=1S/C26H23N3O2/c1-19-17-25(20(2)31-19)26(30)28-27-18-21-13-15-24(16-14-21)29(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-18H,1-2H3,(H,28,30) |
| InChIKey | LUSWZPYVLIJAGG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|