C27H25N3O2S — CID 5171617
2,5-dimethyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]benzenesulfonamide (PubChem CID 5171617) has the molecular formula C27H25N3O2S and a molecular weight of 455.58 g/mol. Its IUPAC name is 2,5-dimethyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 5171617 |
| Molecular Formula | C27H25N3O2S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2,5-dimethyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NN=Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H25N3O2S/c1-21-13-14-22(2)27(19-21)33(31,32)29-28-20-23-15-17-26(18-16-23)30(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-20,29H,1-2H3 |
| InChIKey | ADYJMSQHSVDXFQ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|