C16H18N2O2S — CID 2432038
2,5-dimethyl-N-[(3-methylphenyl)methylideneamino]benzenesulfonamide (PubChem CID 2432038) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(3-methylphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[(3-methylphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 2432038 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2,5-dimethyl-N-[(3-methylphenyl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1cccc(C=NNS(=O)(=O)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C16H18N2O2S/c1-12-5-4-6-15(9-12)11-17-18-21(19,20)16-10-13(2)7-8-14(16)3/h4-11,18H,1-3H3 |
| InChIKey | HVDRCQNWCVXHQN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|