C19H24N2O2S — CID 110515892
5-tert-butyl-2-methyl-N-[(E)-(3-methylphenyl)methylideneamino]benzenesulfonamide (PubChem CID 110515892) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 5-tert-butyl-2-methyl-N-[(E)-(3-methylphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 5-tert-butyl-2-methyl-N-[(E)-(3-methylphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 110515892 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 5-tert-butyl-2-methyl-N-[(E)-(3-methylphenyl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1cccc(/C=N/NS(=O)(=O)c2cc(C(C)(C)C)ccc2C)c1 |
| InChI | InChI=1S/C19H24N2O2S/c1-14-7-6-8-16(11-14)13-20-21-24(22,23)18-12-17(19(3,4)5)10-9-15(18)2/h6-13,21H,1-5H3/b20-13+ |
| InChIKey | FUWLRMNNHCOWKS-DEDYPNTBSA-N |
| XLogP | 3.91 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|