C21H20N2O3S — CID 2362958
2,5-dimethyl-N-[(3-phenoxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 2362958) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(3-phenoxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[(3-phenoxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 2362958 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2,5-dimethyl-N-[(3-phenoxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NN=Cc2cccc(Oc3ccccc3)c2)c1 |
| InChI | InChI=1S/C21H20N2O3S/c1-16-11-12-17(2)21(13-16)27(24,25)23-22-15-18-7-6-10-20(14-18)26-19-8-4-3-5-9-19/h3-15,23H,1-2H3 |
| InChIKey | RHLUKEBEHUAFER-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|