C19H24N2O3S — CID 110517879
N-[(E)-(3-butoxyphenyl)methylideneamino]-2,4-dimethylbenzenesulfonamide (PubChem CID 110517879) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[(E)-(3-butoxyphenyl)methylideneamino]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(E)-(3-butoxyphenyl)methylideneamino]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110517879 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[(E)-(3-butoxyphenyl)methylideneamino]-2,4-dimethylbenzenesulfonamide |
| SMILES | CCCCOc1cccc(/C=N/NS(=O)(=O)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C19H24N2O3S/c1-4-5-11-24-18-8-6-7-17(13-18)14-20-21-25(22,23)19-10-9-15(2)12-16(19)3/h6-10,12-14,21H,4-5,11H2,1-3H3/b20-14+ |
| InChIKey | XUMKCESIKHZQRX-XSFVSMFZSA-N |
| XLogP | 3.79 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|