C24H24N4O3 — CID 91268345
N'-hydroxy-2-methyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]butanediamide (PubChem CID 91268345) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]butanediamide.
| Compound Name | N'-hydroxy-2-methyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]butanediamide |
|---|---|
| PubChem CID | 91268345 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N'-hydroxy-2-methyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]butanediamide |
| SMILES | CC(CC(=O)NO)C(=O)NN=Cc1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N4O3/c1-18(16-23(29)27-31)24(30)26-25-17-19-12-14-22(15-13-19)28(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,17-18,31H,16H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | SAOIERAFXCMQQT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|