C26H28N6S2 — CID 6146871
1-(2-phenylethyl)-3-[(Z)-[4-[(Z)-(2-phenylethylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea (PubChem CID 6146871) has the molecular formula C26H28N6S2 and a molecular weight of 488.69 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-[(Z)-[4-[(Z)-(2-phenylethylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-(2-phenylethyl)-3-[(Z)-[4-[(Z)-(2-phenylethylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 6146871 |
| Molecular Formula | C26H28N6S2 |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 1-(2-phenylethyl)-3-[(Z)-[4-[(Z)-(2-phenylethylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea |
| SMILES | S=C(NCCc1ccccc1)N/N=C\c1ccc(/C=N\NC(=S)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N6S2/c33-25(27-17-15-21-7-3-1-4-8-21)31-29-19-23-11-13-24(14-12-23)20-30-32-26(34)28-18-16-22-9-5-2-6-10-22/h1-14,19-20H,15-18H2,(H2,27,31,33)(H2,28,32,34)/b29-19-,30-20- |
| InChIKey | CHWWVPQTFDEVJH-NAZWXXJZSA-N |
| XLogP | 3.77 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|