C15H13BrFN3S — CID 1209467
1-benzyl-3-[(3-bromo-4-fluorophenyl)methylideneamino]thiourea (PubChem CID 1209467) has the molecular formula C15H13BrFN3S and a molecular weight of 366.26 g/mol. Its IUPAC name is 1-benzyl-3-[(3-bromo-4-fluorophenyl)methylideneamino]thiourea.
| Compound Name | 1-benzyl-3-[(3-bromo-4-fluorophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 1209467 |
| Molecular Formula | C15H13BrFN3S |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 1-benzyl-3-[(3-bromo-4-fluorophenyl)methylideneamino]thiourea |
| SMILES | Fc1ccc(C=NNC(=S)NCc2ccccc2)cc1Br |
| InChI | InChI=1S/C15H13BrFN3S/c16-13-8-12(6-7-14(13)17)10-19-20-15(21)18-9-11-4-2-1-3-5-11/h1-8,10H,9H2,(H2,18,20,21) |
| InChIKey | PCDRBDFQYMXGJW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|