C22H21N3OS — CID 1348293
1-benzyl-3-[(3-phenylmethoxyphenyl)methylideneamino]thiourea (PubChem CID 1348293) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is 1-benzyl-3-[(3-phenylmethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-benzyl-3-[(3-phenylmethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 1348293 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1-benzyl-3-[(3-phenylmethoxyphenyl)methylideneamino]thiourea |
| SMILES | S=C(NCc1ccccc1)NN=Cc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H21N3OS/c27-22(23-15-18-8-3-1-4-9-18)25-24-16-20-12-7-13-21(14-20)26-17-19-10-5-2-6-11-19/h1-14,16H,15,17H2,(H2,23,25,27) |
| InChIKey | QMRILPKTKJOGRE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|