C22H19Cl2N3OS — CID 110340728
1-benzyl-3-[(E)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]thiourea (PubChem CID 110340728) has the molecular formula C22H19Cl2N3OS and a molecular weight of 444.39 g/mol. Its IUPAC name is 1-benzyl-3-[(E)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]thiourea.
| Compound Name | 1-benzyl-3-[(E)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 110340728 |
| Molecular Formula | C22H19Cl2N3OS |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 1-benzyl-3-[(E)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]thiourea |
| SMILES | S=C(NCc1ccccc1)N/N=C/c1cccc(OCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C22H19Cl2N3OS/c23-20-10-5-11-21(24)19(20)15-28-18-9-4-8-17(12-18)14-26-27-22(29)25-13-16-6-2-1-3-7-16/h1-12,14H,13,15H2,(H2,25,27,29)/b26-14+ |
| InChIKey | JTAIVSHHEYOCQG-VULFUBBASA-N |
| XLogP | 5.57 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|