C16H15ClFN3S — CID 42912592
1-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea (PubChem CID 42912592) has the molecular formula C16H15ClFN3S and a molecular weight of 335.84 g/mol. Its IUPAC name is 1-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 42912592 |
| Molecular Formula | C16H15ClFN3S |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea |
| SMILES | Fc1cccc(Cl)c1/C=N/NC(=S)NCCc1ccccc1 |
| InChI | InChI=1S/C16H15ClFN3S/c17-14-7-4-8-15(18)13(14)11-20-21-16(22)19-10-9-12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H2,19,21,22)/b20-11+ |
| InChIKey | BDUVELMMBSSBRN-RGVLZGJSSA-N |
| XLogP | 3.52 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|