C19H24ClFN3S+ — CID 8696561
[(1R)-1-(2-chloro-6-fluorophenyl)-2-(2-phenylethylcarbamothioylamino)ethyl]-dimethylazanium (PubChem CID 8696561) has the molecular formula C19H24ClFN3S+ and a molecular weight of 380.94 g/mol. Its IUPAC name is [(1R)-1-(2-chloro-6-fluorophenyl)-2-(2-phenylethylcarbamothioylamino)ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-(2-chloro-6-fluorophenyl)-2-(2-phenylethylcarbamothioylamino)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8696561 |
| Molecular Formula | C19H24ClFN3S+ |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [(1R)-1-(2-chloro-6-fluorophenyl)-2-(2-phenylethylcarbamothioylamino)ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=S)NCCc1ccccc1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C19H23ClFN3S/c1-24(2)17(18-15(20)9-6-10-16(18)21)13-23-19(25)22-12-11-14-7-4-3-5-8-14/h3-10,17H,11-13H2,1-2H3,(H2,22,23,25)/p+1/t17-/m0/s1 |
| InChIKey | ZOZMLMCCDCVJEJ-KRWDZBQOSA-O |
| XLogP | 2.37 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|