C17H20Cl2N3S+ — CID 8727628
[(1R)-1-(2-chlorophenyl)-2-[(4-chlorophenyl)carbamothioylamino]ethyl]-dimethylazanium (PubChem CID 8727628) has the molecular formula C17H20Cl2N3S+ and a molecular weight of 369.34 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)-2-[(4-chlorophenyl)carbamothioylamino]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-(2-chlorophenyl)-2-[(4-chlorophenyl)carbamothioylamino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8727628 |
| Molecular Formula | C17H20Cl2N3S+ |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)-2-[(4-chlorophenyl)carbamothioylamino]ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=S)Nc1ccc(Cl)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C17H19Cl2N3S/c1-22(2)16(14-5-3-4-6-15(14)19)11-20-17(23)21-13-9-7-12(18)8-10-13/h3-10,16H,11H2,1-2H3,(H2,20,21,23)/p+1/t16-/m0/s1 |
| InChIKey | ZKXFHMYCJIZKGO-INIZCTEOSA-O |
| XLogP | 3.17 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|