C19H25ClN3S+ — CID 8658749
[(1S)-1-(2-chlorophenyl)-2-[(2,3-dimethylphenyl)carbamothioylamino]ethyl]-dimethylazanium (PubChem CID 8658749) has the molecular formula C19H25ClN3S+ and a molecular weight of 362.95 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)-2-[(2,3-dimethylphenyl)carbamothioylamino]ethyl]-dimethylazanium.
| Compound Name | [(1S)-1-(2-chlorophenyl)-2-[(2,3-dimethylphenyl)carbamothioylamino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8658749 |
| Molecular Formula | C19H25ClN3S+ |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)-2-[(2,3-dimethylphenyl)carbamothioylamino]ethyl]-dimethylazanium |
| SMILES | Cc1cccc(NC(=S)NC[C@H](c2ccccc2Cl)[NH+](C)C)c1C |
| InChI | InChI=1S/C19H24ClN3S/c1-13-8-7-11-17(14(13)2)22-19(24)21-12-18(23(3)4)15-9-5-6-10-16(15)20/h5-11,18H,12H2,1-4H3,(H2,21,22,24)/p+1/t18-/m1/s1 |
| InChIKey | ZIPIASYOIQHJEG-GOSISDBHSA-O |
| XLogP | 3.13 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|