C15H24N2O2S — CID 4844611
1-(2,2-diethoxyethyl)-3-(2,3-dimethylphenyl)thiourea (PubChem CID 4844611) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-(2,2-diethoxyethyl)-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 4844611 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-(2,3-dimethylphenyl)thiourea |
| SMILES | CCOC(CNC(=S)Nc1cccc(C)c1C)OCC |
| InChI | InChI=1S/C15H24N2O2S/c1-5-18-14(19-6-2)10-16-15(20)17-13-9-7-8-11(3)12(13)4/h7-9,14H,5-6,10H2,1-4H3,(H2,16,17,20) |
| InChIKey | LCVLYVCSUOPHLE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|