C17H19Cl2FN3S+ — CID 8727723
[(1S)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-1-(2-chlorophenyl)ethyl]-dimethylazanium (PubChem CID 8727723) has the molecular formula C17H19Cl2FN3S+ and a molecular weight of 387.33 g/mol. Its IUPAC name is [(1S)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-1-(2-chlorophenyl)ethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-1-(2-chlorophenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8727723 |
| Molecular Formula | C17H19Cl2FN3S+ |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | [(1S)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-1-(2-chlorophenyl)ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@H](CNC(=S)Nc1ccc(F)c(Cl)c1)c1ccccc1Cl |
| InChI | InChI=1S/C17H18Cl2FN3S/c1-23(2)16(12-5-3-4-6-13(12)18)10-21-17(24)22-11-7-8-15(20)14(19)9-11/h3-9,16H,10H2,1-2H3,(H2,21,22,24)/p+1/t16-/m1/s1 |
| InChIKey | ZUTIRTQJOGFYGM-MRXNPFEDSA-O |
| XLogP | 3.30 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|