C17H24N3OS+ — CID 7945088
[(1S)-1-(furan-2-yl)-2-(2-phenylethylcarbamothioylamino)ethyl]-dimethylazanium (PubChem CID 7945088) has the molecular formula C17H24N3OS+ and a molecular weight of 318.47 g/mol. Its IUPAC name is [(1S)-1-(furan-2-yl)-2-(2-phenylethylcarbamothioylamino)ethyl]-dimethylazanium.
| Compound Name | [(1S)-1-(furan-2-yl)-2-(2-phenylethylcarbamothioylamino)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7945088 |
| Molecular Formula | C17H24N3OS+ |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [(1S)-1-(furan-2-yl)-2-(2-phenylethylcarbamothioylamino)ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=S)NCCc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C17H23N3OS/c1-20(2)15(16-9-6-12-21-16)13-19-17(22)18-11-10-14-7-4-3-5-8-14/h3-9,12,15H,10-11,13H2,1-2H3,(H2,18,19,22)/p+1/t15-/m0/s1 |
| InChIKey | RBVLCWGHGYNZHV-HNNXBMFYSA-O |
| XLogP | 1.17 |
| TPSA | 41.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|