C17H19N2O3+ — CID 7831812
[(1S)-2-(1-benzofuran-2-carbonylamino)-1-(furan-2-yl)ethyl]-dimethylazanium (PubChem CID 7831812) has the molecular formula C17H19N2O3+ and a molecular weight of 299.35 g/mol. Its IUPAC name is [(1S)-2-(1-benzofuran-2-carbonylamino)-1-(furan-2-yl)ethyl]-dimethylazanium.
| Compound Name | [(1S)-2-(1-benzofuran-2-carbonylamino)-1-(furan-2-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7831812 |
| Molecular Formula | C17H19N2O3+ |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [(1S)-2-(1-benzofuran-2-carbonylamino)-1-(furan-2-yl)ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=O)c1cc2ccccc2o1)c1ccco1 |
| InChI | InChI=1S/C17H18N2O3/c1-19(2)13(15-8-5-9-21-15)11-18-17(20)16-10-12-6-3-4-7-14(12)22-16/h3-10,13H,11H2,1-2H3,(H,18,20)/p+1/t13-/m0/s1 |
| InChIKey | ZGVQSQNUUWRKKF-ZDUSSCGKSA-O |
| XLogP | 1.64 |
| TPSA | 59.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |