C15H18BrN2O2+ — CID 7692858
[(1R)-2-[(4-bromobenzoyl)amino]-1-(furan-2-yl)ethyl]-dimethylazanium (PubChem CID 7692858) has the molecular formula C15H18BrN2O2+ and a molecular weight of 338.23 g/mol. Its IUPAC name is [(1R)-2-[(4-bromobenzoyl)amino]-1-(furan-2-yl)ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[(4-bromobenzoyl)amino]-1-(furan-2-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7692858 |
| Molecular Formula | C15H18BrN2O2+ |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | [(1R)-2-[(4-bromobenzoyl)amino]-1-(furan-2-yl)ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@H](CNC(=O)c1ccc(Br)cc1)c1ccco1 |
| InChI | InChI=1S/C15H17BrN2O2/c1-18(2)13(14-4-3-9-20-14)10-17-15(19)11-5-7-12(16)8-6-11/h3-9,13H,10H2,1-2H3,(H,17,19)/p+1/t13-/m1/s1 |
| InChIKey | PNNODXHEPQGAJL-CYBMUJFWSA-O |
| XLogP | 1.66 |
| TPSA | 46.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |