C21H23N2O3+ — CID 8501948
[(1R)-1-(furan-2-yl)-2-[(3-phenoxybenzoyl)amino]ethyl]-dimethylazanium (PubChem CID 8501948) has the molecular formula C21H23N2O3+ and a molecular weight of 351.43 g/mol. Its IUPAC name is [(1R)-1-(furan-2-yl)-2-[(3-phenoxybenzoyl)amino]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-(furan-2-yl)-2-[(3-phenoxybenzoyl)amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8501948 |
| Molecular Formula | C21H23N2O3+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [(1R)-1-(furan-2-yl)-2-[(3-phenoxybenzoyl)amino]ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@H](CNC(=O)c1cccc(Oc2ccccc2)c1)c1ccco1 |
| InChI | InChI=1S/C21H22N2O3/c1-23(2)19(20-12-7-13-25-20)15-22-21(24)16-8-6-11-18(14-16)26-17-9-4-3-5-10-17/h3-14,19H,15H2,1-2H3,(H,22,24)/p+1/t19-/m1/s1 |
| InChIKey | GNISNQHGCGJBSF-LJQANCHMSA-O |
| XLogP | 2.69 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |