C16H18F3N2O2+ — CID 2449545
[(1S)-1-(furan-2-yl)-2-[[2-(trifluoromethyl)benzoyl]amino]ethyl]-dimethylazanium (PubChem CID 2449545) has the molecular formula C16H18F3N2O2+ and a molecular weight of 327.33 g/mol. Its IUPAC name is [(1S)-1-(furan-2-yl)-2-[[2-(trifluoromethyl)benzoyl]amino]ethyl]-dimethylazanium.
| Compound Name | [(1S)-1-(furan-2-yl)-2-[[2-(trifluoromethyl)benzoyl]amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2449545 |
| Molecular Formula | C16H18F3N2O2+ |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [(1S)-1-(furan-2-yl)-2-[[2-(trifluoromethyl)benzoyl]amino]ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=O)c1ccccc1C(F)(F)F)c1ccco1 |
| InChI | InChI=1S/C16H17F3N2O2/c1-21(2)13(14-8-5-9-23-14)10-20-15(22)11-6-3-4-7-12(11)16(17,18)19/h3-9,13H,10H2,1-2H3,(H,20,22)/p+1/t13-/m0/s1 |
| InChIKey | WOIXGZHDTJWLRW-ZDUSSCGKSA-O |
| XLogP | 1.91 |
| TPSA | 46.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |