C17H12F7NO — CID 129410835
N-[(2R)-2-fluoro-2-[2-(trifluoromethyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 129410835) has the molecular formula C17H12F7NO and a molecular weight of 379.28 g/mol. Its IUPAC name is N-[(2R)-2-fluoro-2-[2-(trifluoromethyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(2R)-2-fluoro-2-[2-(trifluoromethyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 129410835 |
| Molecular Formula | C17H12F7NO |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-[(2R)-2-fluoro-2-[2-(trifluoromethyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC[C@H](F)c1ccccc1C(F)(F)F)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H12F7NO/c18-14(10-5-1-3-7-12(10)16(19,20)21)9-25-15(26)11-6-2-4-8-13(11)17(22,23)24/h1-8,14H,9H2,(H,25,26)/t14-/m0/s1 |
| InChIKey | ZVVXWSPDLYKAJK-AWEZNQCLSA-N |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |