C18H14F3NO3 — CID 131701791
N-[2,2-bis(furan-2-yl)ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 131701791) has the molecular formula C18H14F3NO3 and a molecular weight of 349.31 g/mol. Its IUPAC name is N-[2,2-bis(furan-2-yl)ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2,2-bis(furan-2-yl)ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 131701791 |
| Molecular Formula | C18H14F3NO3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[2,2-bis(furan-2-yl)ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(c1ccco1)c1ccco1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H14F3NO3/c19-18(20,21)14-6-2-1-5-12(14)17(23)22-11-13(15-7-3-9-24-15)16-8-4-10-25-16/h1-10,13H,11H2,(H,22,23) |
| InChIKey | QECKSQPHJPKJNH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |