C19H28N3O4S+ — CID 2533073
[(1R)-2-[[4-(diethylsulfamoyl)benzoyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium (PubChem CID 2533073) has the molecular formula C19H28N3O4S+ and a molecular weight of 394.52 g/mol. Its IUPAC name is [(1R)-2-[[4-(diethylsulfamoyl)benzoyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[[4-(diethylsulfamoyl)benzoyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2533073 |
| Molecular Formula | C19H28N3O4S+ |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [(1R)-2-[[4-(diethylsulfamoyl)benzoyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NC[C@H](c2ccco2)[NH+](C)C)cc1 |
| InChI | InChI=1S/C19H27N3O4S/c1-5-22(6-2)27(24,25)16-11-9-15(10-12-16)19(23)20-14-17(21(3)4)18-8-7-13-26-18/h7-13,17H,5-6,14H2,1-4H3,(H,20,23)/p+1/t17-/m1/s1 |
| InChIKey | RAYCKFGTDFZHAU-QGZVFWFLSA-O |
| XLogP | 0.93 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |