C17H25N4O3S2+ — CID 8683336
[(1R)-2-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-1-(furan-2-yl)ethyl]-dimethylazanium (PubChem CID 8683336) has the molecular formula C17H25N4O3S2+ and a molecular weight of 397.55 g/mol. Its IUPAC name is [(1R)-2-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-1-(furan-2-yl)ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-1-(furan-2-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8683336 |
| Molecular Formula | C17H25N4O3S2+ |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | [(1R)-2-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-1-(furan-2-yl)ethyl]-dimethylazanium |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)NC[C@H](c2ccco2)[NH+](C)C)c1 |
| InChI | InChI=1S/C17H24N4O3S2/c1-20(2)15(16-9-6-10-24-16)12-18-17(25)19-13-7-5-8-14(11-13)26(22,23)21(3)4/h5-11,15H,12H2,1-4H3,(H2,18,19,25)/p+1/t15-/m1/s1 |
| InChIKey | JJRGJTDRZNVBRA-OAHLLOKOSA-O |
| XLogP | 0.70 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|