C16H20N4O4S2 — CID 8561609
2-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 8561609) has the molecular formula C16H20N4O4S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 8561609 |
| Molecular Formula | C16H20N4O4S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)NCC(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C16H20N4O4S2/c1-20(2)26(22,23)14-7-3-5-12(9-14)19-16(25)18-11-15(21)17-10-13-6-4-8-24-13/h3-9H,10-11H2,1-2H3,(H,17,21)(H2,18,19,25) |
| InChIKey | HZOQHBSLANXFFV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|