C16H20ClN3O3S2 — CID 8750030
1-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 8750030) has the molecular formula C16H20ClN3O3S2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 1-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8750030 |
| Molecular Formula | C16H20ClN3O3S2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 1-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=S)NCc2ccco2)ccc1Cl |
| InChI | InChI=1S/C16H20ClN3O3S2/c1-3-20(4-2)25(21,22)15-10-12(7-8-14(15)17)19-16(24)18-11-13-6-5-9-23-13/h5-10H,3-4,11H2,1-2H3,(H2,18,19,24) |
| InChIKey | VRQZFYNRPXDAQW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|