C16H21ClN3O4S+ — CID 7995548
[2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium (PubChem CID 7995548) has the molecular formula C16H21ClN3O4S+ and a molecular weight of 386.88 g/mol. Its IUPAC name is [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium.
| Compound Name | [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium |
|---|---|
| PubChem CID | 7995548 |
| Molecular Formula | C16H21ClN3O4S+ |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=O)C[NH+](C)Cc2ccco2)ccc1Cl |
| InChI | InChI=1S/C16H20ClN3O4S/c1-19(2)25(22,23)15-9-12(6-7-14(15)17)18-16(21)11-20(3)10-13-5-4-8-24-13/h4-9H,10-11H2,1-3H3,(H,18,21)/p+1 |
| InChIKey | JGUZGBOVNPAFCZ-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |