C15H19N2O4S+ — CID 8621091
furan-2-ylmethyl-methyl-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium (PubChem CID 8621091) has the molecular formula C15H19N2O4S+ and a molecular weight of 323.39 g/mol. Its IUPAC name is furan-2-ylmethyl-methyl-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium.
| Compound Name | furan-2-ylmethyl-methyl-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8621091 |
| Molecular Formula | C15H19N2O4S+ |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | furan-2-ylmethyl-methyl-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1cccc(S(C)(=O)=O)c1)Cc1ccco1 |
| InChI | InChI=1S/C15H18N2O4S/c1-17(10-13-6-4-8-21-13)11-15(18)16-12-5-3-7-14(9-12)22(2,19)20/h3-9H,10-11H2,1-2H3,(H,16,18)/p+1 |
| InChIKey | RYNWFAYAVVSQCZ-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |