C19H26N3O3+ — CID 8620955
[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium (PubChem CID 8620955) has the molecular formula C19H26N3O3+ and a molecular weight of 344.44 g/mol. Its IUPAC name is [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium.
| Compound Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium |
|---|---|
| PubChem CID | 8620955 |
| Molecular Formula | C19H26N3O3+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)C[NH+](C)Cc2ccco2)c1 |
| InChI | InChI=1S/C19H25N3O3/c1-4-22(5-2)19(24)15-8-6-9-16(12-15)20-18(23)14-21(3)13-17-10-7-11-25-17/h6-12H,4-5,13-14H2,1-3H3,(H,20,23)/p+1 |
| InChIKey | GWNYMMRVRXHBJZ-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |